C19H23ClN2O — CID 119737788
(4-aminophenyl)-(2-phenylazepan-1-yl)methanone;hydrochloride (PubChem CID 119737788) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is (4-aminophenyl)-(2-phenylazepan-1-yl)methanone;hydrochloride.
| Compound Name | (4-aminophenyl)-(2-phenylazepan-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119737788 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (4-aminophenyl)-(2-phenylazepan-1-yl)methanone;hydrochloride |
| SMILES | Cl.Nc1ccc(C(=O)N2CCCCCC2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2O.ClH/c20-17-12-10-16(11-13-17)19(22)21-14-6-2-5-9-18(21)15-7-3-1-4-8-15;/h1,3-4,7-8,10-13,18H,2,5-6,9,14,20H2;1H |
| InChIKey | YTKKDNBWOIOFTP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|