C22H28N2O2 — CID 167491595
phenyl-(2-phenylpiperidin-1-yl)methanone;N-propan-2-ylformamide (PubChem CID 167491595) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is phenyl-(2-phenylpiperidin-1-yl)methanone;N-propan-2-ylformamide.
| Compound Name | phenyl-(2-phenylpiperidin-1-yl)methanone;N-propan-2-ylformamide |
|---|---|
| PubChem CID | 167491595 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | phenyl-(2-phenylpiperidin-1-yl)methanone;N-propan-2-ylformamide |
| SMILES | CC(C)NC=O.O=C(c1ccccc1)N1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C18H19NO.C4H9NO/c20-18(16-11-5-2-6-12-16)19-14-8-7-13-17(19)15-9-3-1-4-10-15;1-4(2)5-3-6/h1-6,9-12,17H,7-8,13-14H2;3-4H,1-2H3,(H,5,6) |
| InChIKey | XBUSRPYMANVKEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|