C28H32N2O2 — CID 177369511
N-phenylformamide;phenyl-[2-(4-propan-2-ylphenyl)piperidin-1-yl]methanone (PubChem CID 177369511) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-phenylformamide;phenyl-[2-(4-propan-2-ylphenyl)piperidin-1-yl]methanone.
| Compound Name | N-phenylformamide;phenyl-[2-(4-propan-2-ylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 177369511 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-phenylformamide;phenyl-[2-(4-propan-2-ylphenyl)piperidin-1-yl]methanone |
| SMILES | CC(C)c1ccc(C2CCCCN2C(=O)c2ccccc2)cc1.O=CNc1ccccc1 |
| InChI | InChI=1S/C21H25NO.C7H7NO/c1-16(2)17-11-13-18(14-12-17)20-10-6-7-15-22(20)21(23)19-8-4-3-5-9-19;9-6-8-7-4-2-1-3-5-7/h3-5,8-9,11-14,16,20H,6-7,10,15H2,1-2H3;1-6H,(H,8,9) |
| InChIKey | XIANCTJIPOYPOW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|