C32H44Br2 — CID 11973933
2,3-bis(bromomethyl)-1,4-dibutyl-5,6,7,8-tetraethylanthracene (PubChem CID 11973933) has the molecular formula C32H44Br2 and a molecular weight of 588.51 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-1,4-dibutyl-5,6,7,8-tetraethylanthracene.
| Compound Name | 2,3-bis(bromomethyl)-1,4-dibutyl-5,6,7,8-tetraethylanthracene |
|---|---|
| PubChem CID | 11973933 |
| Molecular Formula | C32H44Br2 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 2,3-bis(bromomethyl)-1,4-dibutyl-5,6,7,8-tetraethylanthracene |
| SMILES | CCCCc1c(CBr)c(CBr)c(CCCC)c2cc3c(CC)c(CC)c(CC)c(CC)c3cc12 |
| InChI | InChI=1S/C32H44Br2/c1-7-13-15-25-29-17-27-23(11-5)21(9-3)22(10-4)24(12-6)28(27)18-30(29)26(16-14-8-2)32(20-34)31(25)19-33/h17-18H,7-16,19-20H2,1-6H3 |
| InChIKey | WBYNCBREHJCWSD-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|