C18H20ClFN2O3 — CID 119739957
N-[3-[(3-fluorophenyl)methoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119739957) has the molecular formula C18H20ClFN2O3 and a molecular weight of 366.82 g/mol. Its IUPAC name is N-[3-[(3-fluorophenyl)methoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(3-fluorophenyl)methoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119739957 |
| Molecular Formula | C18H20ClFN2O3 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[3-[(3-fluorophenyl)methoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(OCc2cccc(F)c2)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C18H19FN2O3.ClH/c19-13-4-1-3-12(7-13)11-24-16-6-2-5-14(8-16)21-18(23)17-9-15(22)10-20-17;/h1-8,15,17,20,22H,9-11H2,(H,21,23);1H |
| InChIKey | QXJHCYZSRDJWGA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |