C18H23Cl2N3O3 — CID 119858535
N-[6-(3-ethylphenoxy)-3-pyridinyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119858535) has the molecular formula C18H23Cl2N3O3 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-[6-(3-ethylphenoxy)-3-pyridinyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[6-(3-ethylphenoxy)-3-pyridinyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119858535 |
| Molecular Formula | C18H23Cl2N3O3 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[6-(3-ethylphenoxy)-3-pyridinyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CCc1cccc(Oc2ccc(NC(=O)C3CC(O)CN3)cn2)c1.Cl.Cl |
| InChI | InChI=1S/C18H21N3O3.2ClH/c1-2-12-4-3-5-15(8-12)24-17-7-6-13(10-20-17)21-18(23)16-9-14(22)11-19-16;;/h3-8,10,14,16,19,22H,2,9,11H2,1H3,(H,21,23);2*1H |
| InChIKey | AUUQAFJREGULMH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |