C19H21F3N2O2 — CID 119740716
4-amino-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-methylbenzamide (PubChem CID 119740716) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-amino-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-methylbenzamide.
| Compound Name | 4-amino-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 119740716 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-amino-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-methylbenzamide |
| SMILES | Cc1cc(CN(C)C(=O)c2ccc(N)cc2)cc(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C19H21F3N2O2/c1-12-8-14(9-13(2)17(12)26-11-19(20,21)22)10-24(3)18(25)15-4-6-16(23)7-5-15/h4-9H,10-11,23H2,1-3H3 |
| InChIKey | WLQZRIBUNKCPJU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|