C17H25F3N2O3 — CID 119740740
N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide (PubChem CID 119740740) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide.
| Compound Name | N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 119740740 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2-methoxyethylamino)-N-methylacetamide |
| SMILES | COCCNCC(=O)N(C)Cc1cc(C)c(OCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C17H25F3N2O3/c1-12-7-14(8-13(2)16(12)25-11-17(18,19)20)10-22(3)15(23)9-21-5-6-24-4/h7-8,21H,5-6,9-11H2,1-4H3 |
| InChIKey | YZFBZJOVQIGSEV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|