About prop-2-ynyl 4-sulfamoylbenzoate
prop-2-ynyl 4-sulfamoylbenzoate (PubChem CID 11974340) has the molecular formula C10H9NO4S
and a molecular weight of 239.25 g/mol. Its IUPAC name is prop-2-ynyl 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | prop-2-ynyl 4-sulfamoylbenzoate |
| PubChem CID | 11974340 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | prop-2-ynyl 4-sulfamoylbenzoate |
| SMILES | C#CCOC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H9NO4S/c1-2-7-15-10(12)8-3-5-9(6-4-8)16(11,13)14/h1,3-6H,7H2,(H2,11,13,14) |
| InChIKey | IORJVPBKDUGFOJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 4-sulfamoylbenzoate?
The IUPAC name of prop-2-ynyl 4-sulfamoylbenzoate (CID 11974340) is prop-2-ynyl 4-sulfamoylbenzoate.
What is the SMILES notation for prop-2-ynyl 4-sulfamoylbenzoate?
The canonical SMILES for prop-2-ynyl 4-sulfamoylbenzoate is C#CCOC(=O)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of prop-2-ynyl 4-sulfamoylbenzoate?
The InChIKey is IORJVPBKDUGFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4S/c1-2-7-15-10(12)8-3-5-9(6-4-8)16(11,13)14/h1,3-6H,7H2,(H2,11,13,14).
What are the key properties of prop-2-ynyl 4-sulfamoylbenzoate?
prop-2-ynyl 4-sulfamoylbenzoate has a molecular weight of 239.25 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 4-sulfamoylbenzoate is sourced from PubChem (CID 11974340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).