C14H18Cl2N2O — CID 119743617
N-[(3,4-dichlorophenyl)methyl]-N-ethylpyrrolidine-3-carboxamide (PubChem CID 119743617) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-ethylpyrrolidine-3-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-ethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119743617 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-ethylpyrrolidine-3-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C(=O)C1CCNC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-2-18(14(19)11-5-6-17-8-11)9-10-3-4-12(15)13(16)7-10/h3-4,7,11,17H,2,5-6,8-9H2,1H3 |
| InChIKey | HYLUSGIXQHXDPM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |