C14H20Cl2N2 — CID 54923832
N-[(3,4-dichlorophenyl)methyl]-N-ethylpiperidin-4-amine (PubChem CID 54923832) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-ethylpiperidin-4-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 54923832 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-ethylpiperidin-4-amine |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-18(12-5-7-17-8-6-12)10-11-3-4-13(15)14(16)9-11/h3-4,9,12,17H,2,5-8,10H2,1H3 |
| InChIKey | YXRUKLZHZCVDBM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |