C19H22Cl2N2 — CID 23137586
N-[(3,4-dichlorophenyl)methyl]-N-(4-methylphenyl)piperidin-4-amine (PubChem CID 23137586) has the molecular formula C19H22Cl2N2 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-(4-methylphenyl)piperidin-4-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-(4-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 23137586 |
| Molecular Formula | C19H22Cl2N2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-(4-methylphenyl)piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccc(Cl)c(Cl)c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2/c1-14-2-5-16(6-3-14)23(17-8-10-22-11-9-17)13-15-4-7-18(20)19(21)12-15/h2-7,12,17,22H,8-11,13H2,1H3 |
| InChIKey | OHMYYDVMCNVNAA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|