C16H26Cl2N2 — CID 120844817
N-[(3-chloro-4-methylphenyl)methyl]-N-ethylazepan-4-amine;hydrochloride (PubChem CID 120844817) has the molecular formula C16H26Cl2N2 and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)methyl]-N-ethylazepan-4-amine;hydrochloride.
| Compound Name | N-[(3-chloro-4-methylphenyl)methyl]-N-ethylazepan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120844817 |
| Molecular Formula | C16H26Cl2N2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)methyl]-N-ethylazepan-4-amine;hydrochloride |
| SMILES | CCN(Cc1ccc(C)c(Cl)c1)C1CCCNCC1.Cl |
| InChI | InChI=1S/C16H25ClN2.ClH/c1-3-19(15-5-4-9-18-10-8-15)12-14-7-6-13(2)16(17)11-14;/h6-7,11,15,18H,3-5,8-10,12H2,1-2H3;1H |
| InChIKey | KGBZZIPSRXRIQS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |