C15H23Cl2N3O2 — CID 120844783
N-[(3-chloro-4-nitrophenyl)methyl]-N-ethylazepan-4-amine;hydrochloride (PubChem CID 120844783) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[(3-chloro-4-nitrophenyl)methyl]-N-ethylazepan-4-amine;hydrochloride.
| Compound Name | N-[(3-chloro-4-nitrophenyl)methyl]-N-ethylazepan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120844783 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[(3-chloro-4-nitrophenyl)methyl]-N-ethylazepan-4-amine;hydrochloride |
| SMILES | CCN(Cc1ccc([N+](=O)[O-])c(Cl)c1)C1CCCNCC1.Cl |
| InChI | InChI=1S/C15H22ClN3O2.ClH/c1-2-18(13-4-3-8-17-9-7-13)11-12-5-6-15(19(20)21)14(16)10-12;/h5-6,10,13,17H,2-4,7-9,11H2,1H3;1H |
| InChIKey | WCEIOSVDLDCUOX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|