C18H30O4Si — CID 11974674
(1S,5R,6R)-3-[(E)-3-methoxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11974674) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (1S,5R,6R)-3-[(E)-3-methoxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-3-[(E)-3-methoxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11974674 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (1S,5R,6R)-3-[(E)-3-methoxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C(/C=C/C(C)(C)OC)C(=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C18H30O4Si/c1-7-23(8-2,9-3)22-14-12-13(10-11-18(4,5)20-6)15(19)17-16(14)21-17/h10-12,14,16-17H,7-9H2,1-6H3/b11-10+/t14-,16+,17-/m1/s1 |
| InChIKey | CEHWBDIMGVCYJZ-RUXMWWCHSA-N |
| XLogP | 3.63 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|