C17H28O4Si — CID 24822730
(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 24822730) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 24822730 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(O)/C=C/C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C17H28O4Si/c1-16(2,3)22(6,7)21-12-10-11(8-9-17(4,5)19)13(18)15-14(12)20-15/h8-10,12,14-15,19H,1-7H3/b9-8+/t12-,14+,15-/m1/s1 |
| InChIKey | ZZJAAUQOHWMQEE-OXKCXWRWSA-N |
| XLogP | 2.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|