C13H16O5 — CID 139250476
[(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 139250476) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 139250476 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(/C=C/C(C)(C)O)C(=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C13H16O5/c1-7(14)17-9-6-8(4-5-13(2,3)16)10(15)12-11(9)18-12/h4-6,9,11-12,16H,1-3H3/b5-4+/t9-,11+,12-/m1/s1 |
| InChIKey | CIXIYRAUNYMRNW-LEPVOYDJSA-N |
| XLogP | 0.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|