C17H19F3N4O — CID 119748787
2-piperidin-4-yl-N-[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]acetamide (PubChem CID 119748787) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-piperidin-4-yl-N-[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]acetamide.
| Compound Name | 2-piperidin-4-yl-N-[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 119748787 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-piperidin-4-yl-N-[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]acetamide |
| SMILES | O=C(CC1CCNCC1)Nc1ccc(-n2nccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O/c18-17(19,20)15-7-10-22-24(15)14-3-1-13(2-4-14)23-16(25)11-12-5-8-21-9-6-12/h1-4,7,10,12,21H,5-6,8-9,11H2,(H,23,25) |
| InChIKey | OUNPSPXTAIHGGY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |