C17H19F3N4O3 — CID 122077598
4-methyl-4-[[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]carbamoylamino]pentanoic acid (PubChem CID 122077598) has the molecular formula C17H19F3N4O3 and a molecular weight of 384.36 g/mol. Its IUPAC name is 4-methyl-4-[[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122077598 |
| Molecular Formula | C17H19F3N4O3 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-methyl-4-[[4-[5-(trifluoromethyl)pyrazol-1-yl]phenyl]carbamoylamino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccc(-n2nccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N4O3/c1-16(2,9-7-14(25)26)23-15(27)22-11-3-5-12(6-4-11)24-13(8-10-21-24)17(18,19)20/h3-6,8,10H,7,9H2,1-2H3,(H,25,26)(H2,22,23,27) |
| InChIKey | PWKFVLSXSMQSSU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |