C16H19FN4O3 — CID 122078045
4-[(3-fluoro-4-pyrazol-1-ylphenyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 122078045) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-[(3-fluoro-4-pyrazol-1-ylphenyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-fluoro-4-pyrazol-1-ylphenyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122078045 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[(3-fluoro-4-pyrazol-1-ylphenyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccc(-n2cccn2)c(F)c1 |
| InChI | InChI=1S/C16H19FN4O3/c1-16(2,7-6-14(22)23)20-15(24)19-11-4-5-13(12(17)10-11)21-9-3-8-18-21/h3-5,8-10H,6-7H2,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | FAABFLVRRYTDIJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |