C10H15F3N2O2 — CID 119748920
N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide (PubChem CID 119748920) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide.
| Compound Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119748920 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide |
| SMILES | C=CCN(CC(F)(F)F)C(=O)C1CNCCO1 |
| InChI | InChI=1S/C10H15F3N2O2/c1-2-4-15(7-10(11,12)13)9(16)8-6-14-3-5-17-8/h2,8,14H,1,3-7H2 |
| InChIKey | YRQQTJBAKJXLST-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|