C5H5F3N4O2 — CID 11974987
5-(hydroxyamino)-1-methyl-3-(trifluoromethyl)-1,2,4-triazin-6-one (PubChem CID 11974987) has the molecular formula C5H5F3N4O2 and a molecular weight of 210.11 g/mol. Its IUPAC name is 5-(hydroxyamino)-1-methyl-3-(trifluoromethyl)-1,2,4-triazin-6-one.
| Compound Name | 5-(hydroxyamino)-1-methyl-3-(trifluoromethyl)-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 11974987 |
| Molecular Formula | C5H5F3N4O2 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5-(hydroxyamino)-1-methyl-3-(trifluoromethyl)-1,2,4-triazin-6-one |
| SMILES | Cn1nc(C(F)(F)F)nc(NO)c1=O |
| InChI | InChI=1S/C5H5F3N4O2/c1-12-3(13)2(11-14)9-4(10-12)5(6,7)8/h14H,1H3,(H,9,10,11) |
| InChIKey | IJJFZFORNNPTBF-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|