C18H30ClN3O3S — CID 119750157
N-[1-[4-(methylsulfamoyl)phenyl]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119750157) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is N-[1-[4-(methylsulfamoyl)phenyl]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[1-[4-(methylsulfamoyl)phenyl]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119750157 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[1-[4-(methylsulfamoyl)phenyl]ethyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(C(C)NC(=O)CC(C)C2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-13(15-8-10-20-11-9-15)12-18(22)21-14(2)16-4-6-17(7-5-16)25(23,24)19-3;/h4-7,13-15,19-20H,8-12H2,1-3H3,(H,21,22);1H |
| InChIKey | OQHROCFENNKJMA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |