C19H30ClN4O6P — CID 11975177
1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;2-(phosphonomethylamino)acetic acid (PubChem CID 11975177) has the molecular formula C19H30ClN4O6P and a molecular weight of 476.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;2-(phosphonomethylamino)acetic acid.
| Compound Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 11975177 |
| Molecular Formula | C19H30ClN4O6P |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;2-(phosphonomethylamino)acetic acid |
| SMILES | CC(C)(C)C(O)(CCc1ccc(Cl)cc1)Cn1cncn1.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C16H22ClN3O.C3H8NO5P/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13;5-3(6)1-4-2-10(7,8)9/h4-7,11-12,21H,8-10H2,1-3H3;4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | URQFBGHTWGYPFX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|