C16H22ClN3O — CID 165363583
1-(4-chlorophenyl)-1,1,2,2-tetradeuterio-3-[dideuterio(1,2,4-triazol-1-yl)methyl]-4,4-dimethylpentan-3-ol (PubChem CID 165363583) has the molecular formula C16H22ClN3O and a molecular weight of 313.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1,1,2,2-tetradeuterio-3-[dideuterio(1,2,4-triazol-1-yl)methyl]-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(4-chlorophenyl)-1,1,2,2-tetradeuterio-3-[dideuterio(1,2,4-triazol-1-yl)methyl]-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 165363583 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 313.86 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(4-chlorophenyl)-1,1,2,2-tetradeuterio-3-[dideuterio(1,2,4-triazol-1-yl)methyl]-4,4-dimethylpentan-3-ol |
| SMILES | [2H]C([2H])(c1ccc(Cl)cc1)C([2H])([2H])C(O)(C(C)(C)C)C([2H])([2H])n1cncn1 |
| InChI | InChI=1S/C16H22ClN3O/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13/h4-7,11-12,21H,8-10H2,1-3H3/i8D2,9D2,10D2 |
| InChIKey | PXMNMQRDXWABCY-ODBROWPQSA-N |
| XLogP | 3.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |