C19H29N3O3 — CID 119751979
N-[3-[(7-aminoheptanoylamino)methyl]phenyl]oxolane-2-carboxamide (PubChem CID 119751979) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[3-[(7-aminoheptanoylamino)methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[(7-aminoheptanoylamino)methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 119751979 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[3-[(7-aminoheptanoylamino)methyl]phenyl]oxolane-2-carboxamide |
| SMILES | NCCCCCCC(=O)NCc1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C19H29N3O3/c20-11-4-2-1-3-10-18(23)21-14-15-7-5-8-16(13-15)22-19(24)17-9-6-12-25-17/h5,7-8,13,17H,1-4,6,9-12,14,20H2,(H,21,23)(H,22,24) |
| InChIKey | NJVYEBHHHPRHHU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|