C20H25N5O3 — CID 11975205
1-[4-[[4-amino-5-(2-ethoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 11975205) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[4-[[4-amino-5-(2-ethoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-amino-5-(2-ethoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11975205 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[4-[[4-amino-5-(2-ethoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CCOc1ccccc1C(=O)c1cnc(NC2CCN(C(C)=O)CC2)nc1N |
| InChI | InChI=1S/C20H25N5O3/c1-3-28-17-7-5-4-6-15(17)18(27)16-12-22-20(24-19(16)21)23-14-8-10-25(11-9-14)13(2)26/h4-7,12,14H,3,8-11H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | OBDPIVSOXGXWQB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |