C15H26F3N3O2 — CID 119752121
2-pyrrolidin-2-yl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]ethanone (PubChem CID 119752121) has the molecular formula C15H26F3N3O2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]ethanone.
| Compound Name | 2-pyrrolidin-2-yl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 119752121 |
| Molecular Formula | C15H26F3N3O2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-pyrrolidin-2-yl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CC1CCCN1)N1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H26F3N3O2/c16-15(17,18)12-23-10-2-5-20-6-8-21(9-7-20)14(22)11-13-3-1-4-19-13/h13,19H,1-12H2 |
| InChIKey | LBDSROJWQPGJNQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|