C20H30ClFN2O — CID 119752707
N-[1-(4-fluorophenyl)cyclopentyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119752707) has the molecular formula C20H30ClFN2O and a molecular weight of 368.92 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)cyclopentyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[1-(4-fluorophenyl)cyclopentyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119752707 |
| Molecular Formula | C20H30ClFN2O |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[1-(4-fluorophenyl)cyclopentyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NC1(c2ccc(F)cc2)CCCC1)C1CCCNC1.Cl |
| InChI | InChI=1S/C20H29FN2O.ClH/c1-15(16-5-4-12-22-14-16)13-19(24)23-20(10-2-3-11-20)17-6-8-18(21)9-7-17;/h6-9,15-16,22H,2-5,10-14H2,1H3,(H,23,24);1H |
| InChIKey | IQSQDLGEJMSHKI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |