C18H16F4N2O3 — CID 119754433
N-[3-fluoro-4-[2-(trifluoromethyl)phenoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 119754433) has the molecular formula C18H16F4N2O3 and a molecular weight of 384.33 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-(trifluoromethyl)phenoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[3-fluoro-4-[2-(trifluoromethyl)phenoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119754433 |
| Molecular Formula | C18H16F4N2O3 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[3-fluoro-4-[2-(trifluoromethyl)phenoxy]phenyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2C(F)(F)F)c(F)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C18H16F4N2O3/c19-13-7-10(24-17(26)14-8-11(25)9-23-14)5-6-16(13)27-15-4-2-1-3-12(15)18(20,21)22/h1-7,11,14,23,25H,8-9H2,(H,24,26) |
| InChIKey | WARHKWOWKKZMSE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |