C16H24O2 — CID 11975683
(2R,6R)-6-pent-4-enyl-2-propan-2-yl-6-prop-2-enylpyran-3-one (PubChem CID 11975683) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R,6R)-6-pent-4-enyl-2-propan-2-yl-6-prop-2-enylpyran-3-one.
| Compound Name | (2R,6R)-6-pent-4-enyl-2-propan-2-yl-6-prop-2-enylpyran-3-one |
|---|---|
| PubChem CID | 11975683 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2R,6R)-6-pent-4-enyl-2-propan-2-yl-6-prop-2-enylpyran-3-one |
| SMILES | C=CCCC[C@@]1(CC=C)C=CC(=O)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C16H24O2/c1-5-7-8-11-16(10-6-2)12-9-14(17)15(18-16)13(3)4/h5-6,9,12-13,15H,1-2,7-8,10-11H2,3-4H3/t15-,16+/m1/s1 |
| InChIKey | OARDMKSRBWRXHN-CVEARBPZSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|