C10H20ClN3O3 — CID 119758237
2-(2-methoxyethylamino)-N-(1-methyl-5-oxopyrrolidin-3-yl)acetamide;hydrochloride (PubChem CID 119758237) has the molecular formula C10H20ClN3O3 and a molecular weight of 265.74 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(1-methyl-5-oxopyrrolidin-3-yl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(1-methyl-5-oxopyrrolidin-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119758237 |
| Molecular Formula | C10H20ClN3O3 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(1-methyl-5-oxopyrrolidin-3-yl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC1CC(=O)N(C)C1.Cl |
| InChI | InChI=1S/C10H19N3O3.ClH/c1-13-7-8(5-10(13)15)12-9(14)6-11-3-4-16-2;/h8,11H,3-7H2,1-2H3,(H,12,14);1H |
| InChIKey | VMDADMYKWYMVCT-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|