C17H25N3O4 — CID 119803366
2-(2-methoxyethylamino)-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]acetamide (PubChem CID 119803366) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 119803366 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]acetamide |
| SMILES | COCCNCC(=O)NC1CC(=O)N(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-9-7-18-12-16(21)19-14-11-17(22)20(13-14)8-10-24-15-5-3-2-4-6-15/h2-6,14,18H,7-13H2,1H3,(H,19,21) |
| InChIKey | YJSFYHGUBVFJHA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|