C17H23N3O4 — CID 119803338
4-hydroxy-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide (PubChem CID 119803338) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-hydroxy-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119803338 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-hydroxy-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC(=O)N(CCOc2ccccc2)C1)C1CC(O)CN1 |
| InChI | InChI=1S/C17H23N3O4/c21-13-9-15(18-10-13)17(23)19-12-8-16(22)20(11-12)6-7-24-14-4-2-1-3-5-14/h1-5,12-13,15,18,21H,6-11H2,(H,19,23) |
| InChIKey | ZORHIHGBQNDKJW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |