C17H26ClN3O3 — CID 120501604
3-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]butanamide;hydrochloride (PubChem CID 120501604) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]butanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120501604 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]butanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)NC1CC(=O)N(CCOc2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-12(13(2)18)17(22)19-14-10-16(21)20(11-14)8-9-23-15-6-4-3-5-7-15;/h3-7,12-14H,8-11,18H2,1-2H3,(H,19,22);1H |
| InChIKey | XWHNZUHGMVDYGF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |