C20H24ClN3O3 — CID 120636021
5-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]benzamide;hydrochloride (PubChem CID 120636021) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]benzamide;hydrochloride.
| Compound Name | 5-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120636021 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-amino-2-methyl-N-[5-oxo-1-(2-phenoxyethyl)pyrrolidin-3-yl]benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NC1CC(=O)N(CCOc2ccccc2)C1.Cl |
| InChI | InChI=1S/C20H23N3O3.ClH/c1-14-7-8-15(21)11-18(14)20(25)22-16-12-19(24)23(13-16)9-10-26-17-5-3-2-4-6-17;/h2-8,11,16H,9-10,12-13,21H2,1H3,(H,22,25);1H |
| InChIKey | LTULXSJVJMCBRK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|