C19H23ClN2O — CID 119758396
3-amino-N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)benzamide;hydrochloride (PubChem CID 119758396) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 3-amino-N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119758396 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-amino-N-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)benzamide;hydrochloride |
| SMILES | CC1(C)CCC(NC(=O)c2cccc(N)c2)c2ccccc21.Cl |
| InChI | InChI=1S/C19H22N2O.ClH/c1-19(2)11-10-17(15-8-3-4-9-16(15)19)21-18(22)13-6-5-7-14(20)12-13;/h3-9,12,17H,10-11,20H2,1-2H3,(H,21,22);1H |
| InChIKey | RGPZTQXRDSCPDC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|