C14H18ClN5OS — CID 119760632
N-[3-chloro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-(methylamino)butanamide (PubChem CID 119760632) has the molecular formula C14H18ClN5OS and a molecular weight of 339.85 g/mol. Its IUPAC name is N-[3-chloro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3-chloro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119760632 |
| Molecular Formula | C14H18ClN5OS |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[3-chloro-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(Sc2nncn2C)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN5OS/c1-16-7-3-4-13(21)18-10-5-6-12(11(15)8-10)22-14-19-17-9-20(14)2/h5-6,8-9,16H,3-4,7H2,1-2H3,(H,18,21) |
| InChIKey | FZHMFSZASKNLRG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|