C12H18Cl2N2O2 — CID 119760977
4-amino-2-chloro-N-(1-methoxy-2-methylpropan-2-yl)benzamide;hydrochloride (PubChem CID 119760977) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(1-methoxy-2-methylpropan-2-yl)benzamide;hydrochloride.
| Compound Name | 4-amino-2-chloro-N-(1-methoxy-2-methylpropan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119760977 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-amino-2-chloro-N-(1-methoxy-2-methylpropan-2-yl)benzamide;hydrochloride |
| SMILES | COCC(C)(C)NC(=O)c1ccc(N)cc1Cl.Cl |
| InChI | InChI=1S/C12H17ClN2O2.ClH/c1-12(2,7-17-3)15-11(16)9-5-4-8(14)6-10(9)13;/h4-6H,7,14H2,1-3H3,(H,15,16);1H |
| InChIKey | ZORLYYYSCZNCMS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|