C19H24N4O4 — CID 119761069
4-hydroxy-N-[1-(2-morpholin-4-yl-2-oxoethyl)indol-5-yl]pyrrolidine-2-carboxamide (PubChem CID 119761069) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-hydroxy-N-[1-(2-morpholin-4-yl-2-oxoethyl)indol-5-yl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[1-(2-morpholin-4-yl-2-oxoethyl)indol-5-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119761069 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-hydroxy-N-[1-(2-morpholin-4-yl-2-oxoethyl)indol-5-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(ccn2CC(=O)N2CCOCC2)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C19H24N4O4/c24-15-10-16(20-11-15)19(26)21-14-1-2-17-13(9-14)3-4-23(17)12-18(25)22-5-7-27-8-6-22/h1-4,9,15-16,20,24H,5-8,10-12H2,(H,21,26) |
| InChIKey | VDOQPOFSAWXJAF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |