C18H26N2O4 — CID 119797799
4-hydroxy-N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]pyrrolidine-2-carboxamide (PubChem CID 119797799) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-hydroxy-N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119797799 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-hydroxy-N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC(O)CN2)cc1OCC1CCOCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-12-2-3-14(20-18(22)16-9-15(21)10-19-16)8-17(12)24-11-13-4-6-23-7-5-13/h2-3,8,13,15-16,19,21H,4-7,9-11H2,1H3,(H,20,22) |
| InChIKey | RBKIDKAQIUBHQS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |