C19H29ClN2O3S — CID 119939630
N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119939630) has the molecular formula C19H29ClN2O3S and a molecular weight of 400.97 g/mol. Its IUPAC name is N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119939630 |
| Molecular Formula | C19H29ClN2O3S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[4-methyl-3-(oxan-4-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CC2CSCCN2)cc1OCC1CCOCC1.Cl |
| InChI | InChI=1S/C19H28N2O3S.ClH/c1-14-2-3-16(21-19(22)11-17-13-25-9-6-20-17)10-18(14)24-12-15-4-7-23-8-5-15;/h2-3,10,15,17,20H,4-9,11-13H2,1H3,(H,21,22);1H |
| InChIKey | DOQQEAIYCXQLQE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |