C19H23ClN6O — CID 119764922
3-amino-N-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]butanamide;hydrochloride (PubChem CID 119764922) has the molecular formula C19H23ClN6O and a molecular weight of 386.89 g/mol. Its IUPAC name is 3-amino-N-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119764922 |
| Molecular Formula | C19H23ClN6O |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-amino-N-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)Nc1ccc(CCn2nnc(-c3ccccc3)n2)cc1.Cl |
| InChI | InChI=1S/C19H22N6O.ClH/c1-14(20)13-18(26)21-17-9-7-15(8-10-17)11-12-25-23-19(22-24-25)16-5-3-2-4-6-16;/h2-10,14H,11-13,20H2,1H3,(H,21,26);1H |
| InChIKey | VZURPHROVVPDQZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |