C24H32N8O2 — CID 167832296
N-[3-[3-aminopropyl(methyl)amino]propyl]-N'-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]oxamide (PubChem CID 167832296) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[3-[3-aminopropyl(methyl)amino]propyl]-N'-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]oxamide.
| Compound Name | N-[3-[3-aminopropyl(methyl)amino]propyl]-N'-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]oxamide |
|---|---|
| PubChem CID | 167832296 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[3-[3-aminopropyl(methyl)amino]propyl]-N'-[4-[2-(5-phenyltetrazol-2-yl)ethyl]phenyl]oxamide |
| SMILES | CN(CCCN)CCCNC(=O)C(=O)Nc1ccc(CCn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H32N8O2/c1-31(16-5-14-25)17-6-15-26-23(33)24(34)27-21-11-9-19(10-12-21)13-18-32-29-22(28-30-32)20-7-3-2-4-8-20/h2-4,7-12H,5-6,13-18,25H2,1H3,(H,26,33)(H,27,34) |
| InChIKey | NOABTIYQNIXQIN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|