C16H27ClN2O — CID 119765445
4-(methylamino)-N-(3-methyl-3-phenylbutan-2-yl)butanamide;hydrochloride (PubChem CID 119765445) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 4-(methylamino)-N-(3-methyl-3-phenylbutan-2-yl)butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-(3-methyl-3-phenylbutan-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119765445 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-(methylamino)-N-(3-methyl-3-phenylbutan-2-yl)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC(C)C(C)(C)c1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-13(18-15(19)11-8-12-17-4)16(2,3)14-9-6-5-7-10-14;/h5-7,9-10,13,17H,8,11-12H2,1-4H3,(H,18,19);1H |
| InChIKey | NSUVNGWJVSOXKD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|