C20H34O8 — CID 11976678
(2S)-2-[(2S)-2-(2,3-dihydroxypropoxycarbonyl)-5-oxooxolan-2-yl]dodecanoic acid (PubChem CID 11976678) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-(2,3-dihydroxypropoxycarbonyl)-5-oxooxolan-2-yl]dodecanoic acid.
| Compound Name | (2S)-2-[(2S)-2-(2,3-dihydroxypropoxycarbonyl)-5-oxooxolan-2-yl]dodecanoic acid |
|---|---|
| PubChem CID | 11976678 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2S)-2-[(2S)-2-(2,3-dihydroxypropoxycarbonyl)-5-oxooxolan-2-yl]dodecanoic acid |
| SMILES | CCCCCCCCCC[C@H](C(=O)O)[C@]1(C(=O)OCC(O)CO)CCC(=O)O1 |
| InChI | InChI=1S/C20H34O8/c1-2-3-4-5-6-7-8-9-10-16(18(24)25)20(12-11-17(23)28-20)19(26)27-14-15(22)13-21/h15-16,21-22H,2-14H2,1H3,(H,24,25)/t15?,16-,20+/m1/s1 |
| InChIKey | UCCVNDWRNVGPSE-ZHXBYJNYSA-N |
| XLogP | 2.19 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|