C22H28ClN3O3 — CID 119767253
N-[1-[2-(3-methoxyphenyl)acetyl]-2,3-dihydroindol-6-yl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119767253) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-[1-[2-(3-methoxyphenyl)acetyl]-2,3-dihydroindol-6-yl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[1-[2-(3-methoxyphenyl)acetyl]-2,3-dihydroindol-6-yl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119767253 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[1-[2-(3-methoxyphenyl)acetyl]-2,3-dihydroindol-6-yl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1ccc2c(c1)N(C(=O)Cc1cccc(OC)c1)CC2.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-23-11-4-7-21(26)24-18-9-8-17-10-12-25(20(17)15-18)22(27)14-16-5-3-6-19(13-16)28-2;/h3,5-6,8-9,13,15,23H,4,7,10-12,14H2,1-2H3,(H,24,26);1H |
| InChIKey | SHYLPZKUYVGBBT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|