C18H26F2N2O — CID 119767607
N-[(2,6-difluorophenyl)methyl]-N-ethyl-3-piperidin-3-ylbutanamide (PubChem CID 119767607) has the molecular formula C18H26F2N2O and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-N-ethyl-3-piperidin-3-ylbutanamide.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-N-ethyl-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119767607 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-N-ethyl-3-piperidin-3-ylbutanamide |
| SMILES | CCN(Cc1c(F)cccc1F)C(=O)CC(C)C1CCCNC1 |
| InChI | InChI=1S/C18H26F2N2O/c1-3-22(12-15-16(19)7-4-8-17(15)20)18(23)10-13(2)14-6-5-9-21-11-14/h4,7-8,13-14,21H,3,5-6,9-12H2,1-2H3 |
| InChIKey | RWQUFNRVRGKHGN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |