C14H19BrClN5O — CID 119769685
N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119769685) has the molecular formula C14H19BrClN5O and a molecular weight of 388.70 g/mol. Its IUPAC name is N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119769685 |
| Molecular Formula | C14H19BrClN5O |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCc1nc(-c2ccc(Br)cc2)n[nH]1.Cl |
| InChI | InChI=1S/C14H18BrN5O.ClH/c1-16-8-2-3-13(21)17-9-12-18-14(20-19-12)10-4-6-11(15)7-5-10;/h4-7,16H,2-3,8-9H2,1H3,(H,17,21)(H,18,19,20);1H |
| InChIKey | FSEBSJLCLXFXGB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|