C19H21ClF2N2O — CID 119771657
3-amino-N-[4-fluoro-2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119771657) has the molecular formula C19H21ClF2N2O and a molecular weight of 366.84 g/mol. Its IUPAC name is 3-amino-N-[4-fluoro-2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[4-fluoro-2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119771657 |
| Molecular Formula | C19H21ClF2N2O |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-amino-N-[4-fluoro-2-(4-fluorophenyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)Nc2ccc(F)cc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H20F2N2O.ClH/c20-14-6-4-12(5-7-14)17-11-15(21)8-9-18(17)23-19(24)13-2-1-3-16(22)10-13;/h4-9,11,13,16H,1-3,10,22H2,(H,23,24);1H |
| InChIKey | BCBYNLDXNKBDCA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |